Products 1598806-79-1

CAS 1598806-79-1 appears in our catalog under these names: 2–(2,6–dimethoxyphenyl)propanoic acid, 2-(2,6-dimethoxyphenyl)propanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(2,6-dimethoxyphenyl)propanoic acid (CAS 1598806-79-1) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2,6-dimethoxyphenyl)propanoic acid. InChIKey: YOHDJOHDQXXSRB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O4
Molecular weight210.23 g/mol
IUPAC name2-(2,6-dimethoxyphenyl)propanoic acid
InChIKeyYOHDJOHDQXXSRB-UHFFFAOYSA-N
SMILESCC(C1=C(C=CC=C1OC)OC)C(=O)O

Computed by PubChem (NCBI)