CAS 159898-15-4 appears in our catalog under these names: 1-Bromo-9H-pyrido[3,4-b]indole, 95%, 95%, 1-Bromo-9H-pyrido[3,4-b]indole, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
1-bromo-9H-pyrido[3,4-b]indole (CAS 159898-15-4) is a chemical compound with the molecular formula C11H7BrN2 and a molecular weight of 247.09 g/mol. IUPAC name: 1-bromo-9H-pyrido[3,4-b]indole. InChIKey: BFBBBZFKYUWJSV-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 1-bromo-9H-pyrido[3,4-b]indole |
| InChIKey | BFBBBZFKYUWJSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)Br |
Computed by PubChem (NCBI)