CAS 160115-16-2 is the registry number for 6-Acetamido-3-chloro-2-picoline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
N-(5-chloro-6-methyl-2-pyridinyl)acetamide (CAS 160115-16-2) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: N-(5-chloro-6-methyl-2-pyridinyl)acetamide. InChIKey: RCNCLJXNLLFOFB-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | N-(5-chloro-6-methyl-2-pyridinyl)acetamide |
| InChIKey | RCNCLJXNLLFOFB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)NC(=O)C)Cl |
Computed by PubChem (NCBI)