Products 160149-03-1
CAS 160149-03-1 is the registry number for 4-(BROMOMETHYL)-2-PHENYL-4,5-DIHYDROOXAZOLE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(bromomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole (CAS 160149-03-1) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 4-(bromomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: XBYZRCKWDUWPOC-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 4-(bromomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | XBYZRCKWDUWPOC-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)C2=CC=CC=C2)CBr |
Computed by PubChem (NCBI)