Products 1602857-90-8

CAS 1602857-90-8 is the registry number for Metaraminol Bitartrate Impurity 37. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-[(1S,2R)-1-hydroxy-2-nitropropyl]phenol (CAS 1602857-90-8) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 3-[(1S,2R)-1-hydroxy-2-nitropropyl]phenol. InChIKey: YKJVNSQPZQAZHC-HZGVNTEJSA-N.

Identity
Molecular formulaC9H11NO4
Molecular weight197.19 g/mol
IUPAC name3-[(1S,2R)-1-hydroxy-2-nitropropyl]phenol
InChIKeyYKJVNSQPZQAZHC-HZGVNTEJSA-N
SMILESC[C@H]([C@H](C1=CC(=CC=C1)O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)