CAS 1602857-94-2 is the registry number for Metaraminol Bitartrate Impurity 38. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(1R,2R)-1-hydroxy-2-nitropropyl]phenol (CAS 1602857-94-2) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 3-[(1R,2R)-1-hydroxy-2-nitropropyl]phenol. InChIKey: YKJVNSQPZQAZHC-MUWHJKNJSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 3-[(1R,2R)-1-hydroxy-2-nitropropyl]phenol |
| InChIKey | YKJVNSQPZQAZHC-MUWHJKNJSA-N |
| SMILES | C[C@H]([C@@H](C1=CC(=CC=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)