CAS 1602864-91-4 is the registry number for 2-(4-Bromo-3,5-dimethylphenyl)-1H-imidazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-3,5-dimethylphenyl)-1H-imidazole-5-carbaldehyde (CAS 1602864-91-4) is a chemical compound with the molecular formula C12H11BrN2O and a molecular weight of 279.13 g/mol. IUPAC name: 2-(4-bromo-3,5-dimethylphenyl)-1H-imidazole-5-carbaldehyde. InChIKey: LKZKJZWVGVABGY-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 2-(4-bromo-3,5-dimethylphenyl)-1H-imidazole-5-carbaldehyde |
| InChIKey | LKZKJZWVGVABGY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C2=NC=C(N2)C=O |
Computed by PubChem (NCBI)