CAS 2166726-90-3 is the registry number for 6-(4-Bromophenyl)-5,7-diazaspiro[3.4]oct-5-en-8-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4-bromophenyl)-5,7-diazaspiro[3.4]oct-5-en-8-one (CAS 2166726-90-3) is a chemical compound with the molecular formula C12H11BrN2O and a molecular weight of 279.13 g/mol. IUPAC name: 6-(4-bromophenyl)-5,7-diazaspiro[3.4]oct-5-en-8-one. InChIKey: RBQYLPVRCOITAM-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 6-(4-bromophenyl)-5,7-diazaspiro[3.4]oct-5-en-8-one |
| InChIKey | RBQYLPVRCOITAM-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C(=O)NC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)