CAS 43156-11-2 is the registry number for 4-(4-Bromophenoxy)benzene-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-bromophenoxy)benzene-1,2-diamine (CAS 43156-11-2) is a chemical compound with the molecular formula C12H11BrN2O and a molecular weight of 279.13 g/mol. IUPAC name: 4-(4-bromophenoxy)benzene-1,2-diamine. InChIKey: DRJZHRFCQYNKGM-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 4-(4-bromophenoxy)benzene-1,2-diamine |
| InChIKey | DRJZHRFCQYNKGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)N)N)Br |
Computed by PubChem (NCBI)