Products 1603080-31-4
CAS 1603080-31-4 is the registry number for 1-bromo-2-(2-bromoethoxy)-3,5-difluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-(2-bromoethoxy)-3,5-difluorobenzene (CAS 1603080-31-4) is a chemical compound with the molecular formula C8H6Br2F2O and a molecular weight of 315.94 g/mol. IUPAC name: 1-bromo-2-(2-bromoethoxy)-3,5-difluorobenzene. InChIKey: LPRZWINQDPUACY-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2O |
|---|---|
| Molecular weight | 315.94 g/mol |
| IUPAC name | 1-bromo-2-(2-bromoethoxy)-3,5-difluorobenzene |
| InChIKey | LPRZWINQDPUACY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCCBr)Br)F |
Computed by PubChem (NCBI)