Products 2764729-10-2
CAS 2764729-10-2 is the registry number for 1-(3,5-dibromo-2,6-difluorophenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3,5-dibromo-2,6-difluorophenyl)ethanol (CAS 2764729-10-2) is a chemical compound with the molecular formula C8H6Br2F2O and a molecular weight of 315.94 g/mol. IUPAC name: 1-(3,5-dibromo-2,6-difluorophenyl)ethanol. InChIKey: APIJVCQFEPUTDN-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2O |
|---|---|
| Molecular weight | 315.94 g/mol |
| IUPAC name | 1-(3,5-dibromo-2,6-difluorophenyl)ethanol |
| InChIKey | APIJVCQFEPUTDN-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC(=C1F)Br)Br)F)O |
Computed by PubChem (NCBI)