CAS 2809470-43-5 is the registry number for 1,3-Dibromo-5-(2,2-difluoroethoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-5-(2,2-difluoroethoxy)benzene (CAS 2809470-43-5) is a chemical compound with the molecular formula C8H6Br2F2O and a molecular weight of 315.94 g/mol. IUPAC name: 1,3-dibromo-5-(2,2-difluoroethoxy)benzene. InChIKey: WJZGEFZYLXRDAJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2O |
|---|---|
| Molecular weight | 315.94 g/mol |
| IUPAC name | 1,3-dibromo-5-(2,2-difluoroethoxy)benzene |
| InChIKey | WJZGEFZYLXRDAJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)OCC(F)F |
Computed by PubChem (NCBI)