Products 1603111-54-1
CAS 1603111-54-1 is the registry number for 3-(4-(Trifluoromethyl)pyridin-3-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[4-(trifluoromethyl)-3-pyridinyl]propanoic acid (CAS 1603111-54-1) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 3-[4-(trifluoromethyl)-3-pyridinyl]propanoic acid. InChIKey: LKVDCFMYNUOEDD-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)-3-pyridinyl]propanoic acid |
| InChIKey | LKVDCFMYNUOEDD-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)CCC(=O)O |
Computed by PubChem (NCBI)