CAS 16032-35-2 appears in our catalog under these names: Quinolin-8-ylmethanol, 98%, Quinolin-8-ylmethanol, 95%, 95%, Quinolin-8-ylmethanol, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg.
Quinolin-8-ylmethanol (CAS 16032-35-2) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: quinolin-8-ylmethanol. InChIKey: BGLZVNYGUGILJU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | quinolin-8-ylmethanol |
| InChIKey | BGLZVNYGUGILJU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CO)N=CC=C2 |
Computed by PubChem (NCBI)