Products 16033-23-1
CAS 16033-23-1 appears in our catalog under these names: Cytidine Impurity 5, Cytarabine Impurity 50, Azacitidine Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 16033-23-1) is a chemical compound with the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: UHDGCWIWMRVCDJ-ZAKLUEHWSA-N.
| Molecular formula | C9H13N3O5 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | UHDGCWIWMRVCDJ-ZAKLUEHWSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@H]([C@@H](O2)CO)O)O |
Computed by PubChem (NCBI)