CAS 89618-11-1 appears in our catalog under these names: Azacitidine Impurity 20, Azacitidine Impurity R. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 89618-11-1) is a chemical compound with the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. IUPAC name: 4-amino-1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: UHDGCWIWMRVCDJ-YTQLPXDHSA-N.
| Molecular formula | C9H13N3O5 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 4-amino-1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | UHDGCWIWMRVCDJ-YTQLPXDHSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@@H]2[C@H]([C@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)