CAS 1001500-79-3 is the registry number for Ethyl 3-(3-methoxy-4-nitro-1h-pyrazol-1-yl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 3-(3-methoxy-4-nitropyrazol-1-yl)propanoate (CAS 1001500-79-3) is a chemical compound with the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. IUPAC name: ethyl 3-(3-methoxy-4-nitropyrazol-1-yl)propanoate. InChIKey: KAJICRPGNPRJSH-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O5 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | ethyl 3-(3-methoxy-4-nitropyrazol-1-yl)propanoate |
| InChIKey | KAJICRPGNPRJSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN1C=C(C(=N1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)