CAS 1603890-90-9 is the registry number for 4-Bromo-2-ethoxy-N-hydroxybenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-ethoxy-N'-hydroxybenzenecarboximidamide (CAS 1603890-90-9) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromo-2-ethoxy-N'-hydroxybenzenecarboximidamide. InChIKey: UQGQOCYXFZJNHZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-bromo-2-ethoxy-N'-hydroxybenzenecarboximidamide |
| InChIKey | UQGQOCYXFZJNHZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)Br)/C(=N/O)/N |
Computed by PubChem (NCBI)