Products 160415-03-2

CAS 160415-03-2 is the registry number for 2-(5,5-Dimethylmorpholin-2-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(5,5-dimethylmorpholin-2-yl)acetic acid;hydrochloride (CAS 160415-03-2) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: 2-(5,5-dimethylmorpholin-2-yl)acetic acid;hydrochloride. InChIKey: QYYBBASPKHNBKA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO3
Molecular weight209.67 g/mol
IUPAC name2-(5,5-dimethylmorpholin-2-yl)acetic acid;hydrochloride
InChIKeyQYYBBASPKHNBKA-UHFFFAOYSA-N
SMILESCC1(COC(CN1)CC(=O)O)C.Cl

Computed by PubChem (NCBI)