CAS 160415-07-6 appears in our catalog under these names: 2-((2S)-5,5-Dimethylmorpholin-2-yl)acetic acid, SCH 50911 (hydrochloride). Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, 250mg, Get quote.
2-[(2S)-5,5-dimethylmorpholin-2-yl]acetic acid;hydrochloride (CAS 160415-07-6) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: 2-[(2S)-5,5-dimethylmorpholin-2-yl]acetic acid;hydrochloride. InChIKey: QYYBBASPKHNBKA-RGMNGODLSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 2-[(2S)-5,5-dimethylmorpholin-2-yl]acetic acid;hydrochloride |
| InChIKey | QYYBBASPKHNBKA-RGMNGODLSA-N |
| SMILES | CC1(CO[C@H](CN1)CC(=O)O)C.Cl |
Computed by PubChem (NCBI)