CAS 1604634-86-7 is the registry number for 1-((2,5-Dimethylphenyl)sulfonyl)pyrrolidin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,5-dimethylphenyl)sulfonylpyrrolidin-3-amine (CAS 1604634-86-7) is a chemical compound with the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. IUPAC name: 1-(2,5-dimethylphenyl)sulfonylpyrrolidin-3-amine. InChIKey: YMRJTLDJUMNLDY-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 1-(2,5-dimethylphenyl)sulfonylpyrrolidin-3-amine |
| InChIKey | YMRJTLDJUMNLDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)N2CCC(C2)N |
Computed by PubChem (NCBI)