Products 1604641-88-4

CAS 1604641-88-4 is the registry number for Ethyl 4-(piperidine-2-carboxamido)butanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-(piperidine-2-carbonylamino)butanoate;hydrochloride (CAS 1604641-88-4) is a chemical compound with the molecular formula C12H23ClN2O3 and a molecular weight of 278.77 g/mol. IUPAC name: ethyl 4-(piperidine-2-carbonylamino)butanoate;hydrochloride. InChIKey: IEMBWNXTQZPECR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O3
Molecular weight278.77 g/mol
IUPAC nameethyl 4-(piperidine-2-carbonylamino)butanoate;hydrochloride
InChIKeyIEMBWNXTQZPECR-UHFFFAOYSA-N
SMILESCCOC(=O)CCCNC(=O)C1CCCCN1.Cl

Computed by PubChem (NCBI)