Products 2306275-50-1

CAS 2306275-50-1 is the registry number for tert-Butyl 3-(pyrrolidin-3-yloxy)azetidine-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 3-pyrrolidin-3-yloxyazetidine-1-carboxylate;hydrochloride (CAS 2306275-50-1) is a chemical compound with the molecular formula C12H23ClN2O3 and a molecular weight of 278.77 g/mol. IUPAC name: tert-butyl 3-pyrrolidin-3-yloxyazetidine-1-carboxylate;hydrochloride. InChIKey: UUJWLTYVYACSRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O3
Molecular weight278.77 g/mol
IUPAC nametert-butyl 3-pyrrolidin-3-yloxyazetidine-1-carboxylate;hydrochloride
InChIKeyUUJWLTYVYACSRZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C1)OC2CCNC2.Cl

Computed by PubChem (NCBI)