Products 2095192-22-4

CAS 2095192-22-4 is the registry number for tert-Butyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate;hydrochloride (CAS 2095192-22-4) is a chemical compound with the molecular formula C12H23ClN2O3 and a molecular weight of 278.77 g/mol. IUPAC name: tert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate;hydrochloride. InChIKey: WGLCTNVOFYGCFK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O3
Molecular weight278.77 g/mol
IUPAC nametert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate;hydrochloride
InChIKeyWGLCTNVOFYGCFK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOC2(C1)CCNC2.Cl

Computed by PubChem (NCBI)