CAS 16053-39-7 appears in our catalog under these names: H-Phe-ser-oh, 95%, L-Phenylalanyl-L-serine, 97%, H–Phe–Ser–OH, H-Phe-Ser-OH, H-Phe-Ser-OH, 99.65%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10G, 1g, 250mg, 5g, 2000mg, 5000mg, 10000mg, 5 mg.
Phe-Ser is a dipeptide that is the N-(L-phenylalanyl) derivative of L-serine. It has a role as a metabolite. It is functionally related to a L-serine and a L-phenylalanine.
Source: ChEBI
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid |
| InChIKey | ROHDXJUFQVRDAV-UWVGGRQHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)N |
Computed by PubChem (NCBI)