CAS 16053-97-7 is the registry number for VF-149. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,2,3-trihydroxybenzamide (CAS 16053-97-7) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: N,2,3-trihydroxybenzamide. InChIKey: FIDAFVPRXYXHSB-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | N,2,3-trihydroxybenzamide |
| InChIKey | FIDAFVPRXYXHSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C(=O)NO |
Computed by PubChem (NCBI)