Products 160592-73-4

CAS 160592-73-4 is the registry number for 3-Hydroxynaphthalene-2,7-dicarboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-hydroxynaphthalene-2,7-dicarboxylic acid (CAS 160592-73-4) is a chemical compound with the molecular formula C12H8O5 and a molecular weight of 232.19 g/mol. IUPAC name: 3-hydroxynaphthalene-2,7-dicarboxylic acid. InChIKey: TVBXXOVRWRDFMB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8O5
Molecular weight232.19 g/mol
IUPAC name3-hydroxynaphthalene-2,7-dicarboxylic acid
InChIKeyTVBXXOVRWRDFMB-UHFFFAOYSA-N
SMILESC1=CC(=CC2=CC(=C(C=C21)O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)