CAS 160592-73-4 is the registry number for 3-Hydroxynaphthalene-2,7-dicarboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxynaphthalene-2,7-dicarboxylic acid (CAS 160592-73-4) is a chemical compound with the molecular formula C12H8O5 and a molecular weight of 232.19 g/mol. IUPAC name: 3-hydroxynaphthalene-2,7-dicarboxylic acid. InChIKey: TVBXXOVRWRDFMB-UHFFFAOYSA-N.
| Molecular formula | C12H8O5 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 3-hydroxynaphthalene-2,7-dicarboxylic acid |
| InChIKey | TVBXXOVRWRDFMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)