CAS 436088-45-8 is the registry number for 4-(5-Formyl-furan-2-yl)-2-hydroxy-benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(5-formylfuran-2-yl)-2-hydroxybenzoic acid (CAS 436088-45-8) is a chemical compound with the molecular formula C12H8O5 and a molecular weight of 232.19 g/mol. IUPAC name: 4-(5-formylfuran-2-yl)-2-hydroxybenzoic acid. InChIKey: BKNVVYRQMKQLFC-UHFFFAOYSA-N.
| Molecular formula | C12H8O5 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 4-(5-formylfuran-2-yl)-2-hydroxybenzoic acid |
| InChIKey | BKNVVYRQMKQLFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=C(O2)C=O)O)C(=O)O |
Computed by PubChem (NCBI)