CAS 16064-30-5 is the registry number for (1S)-2-(4-Chlorophenyl)-1-methylethylamine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(2S)-1-(4-chlorophenyl)propan-2-amine;hydrochloride (CAS 16064-30-5) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: (2S)-1-(4-chlorophenyl)propan-2-amine;hydrochloride. InChIKey: DZAANUYJOGCNLL-FJXQXJEOSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | (2S)-1-(4-chlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | DZAANUYJOGCNLL-FJXQXJEOSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)