CAS 16066-93-6 appears in our catalog under these names: 1-(5-Amino-1h-indol-1-yl)ethanone, 95%, 1–Acetyl–5–aminoindole, 1-Acetyl-5-aminoindole, 97%, 97%, 1-Acetyl-5-aminoindole, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
1-(5-aminoindol-1-yl)ethanone (CAS 16066-93-6) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1-(5-aminoindol-1-yl)ethanone. InChIKey: MNKQEYHXWMJMGA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-(5-aminoindol-1-yl)ethanone |
| InChIKey | MNKQEYHXWMJMGA-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=CC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)