CAS 1607470-18-7 is the registry number for 7-Methyl-11h-benzo[a]carbazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
7-methyl-11H-benzo[a]carbazole (CAS 1607470-18-7) is a chemical compound with the molecular formula C17H13N and a molecular weight of 231.29 g/mol. IUPAC name: 7-methyl-11H-benzo[a]carbazole. InChIKey: IIPGCEXITIWWSN-UHFFFAOYSA-N.
| Molecular formula | C17H13N |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 7-methyl-11H-benzo[a]carbazole |
| InChIKey | IIPGCEXITIWWSN-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(C4=CC=CC=C4C=C3)NC2=CC=C1 |
Computed by PubChem (NCBI)