Products 93324-68-6
CAS 93324-68-6 is the registry number for 3-(1,1’-Biphenyl)4-yl-pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-(4-phenylphenyl)pyridine (CAS 93324-68-6) is a chemical compound with the molecular formula C17H13N and a molecular weight of 231.29 g/mol. IUPAC name: 3-(4-phenylphenyl)pyridine. InChIKey: OIWJBXODTRCYHF-UHFFFAOYSA-N.
| Molecular formula | C17H13N |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3-(4-phenylphenyl)pyridine |
| InChIKey | OIWJBXODTRCYHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)