CAS 458541-39-4 is the registry number for 2-((1,1'-Biphenyl)-3-yl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2-(3-phenylphenyl)pyridine (CAS 458541-39-4) is a chemical compound with the molecular formula C17H13N and a molecular weight of 231.29 g/mol. IUPAC name: 2-(3-phenylphenyl)pyridine. InChIKey: QWVOHJGKYCTVIR-UHFFFAOYSA-N.
| Molecular formula | C17H13N |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2-(3-phenylphenyl)pyridine |
| InChIKey | QWVOHJGKYCTVIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)