Products 458541-39-4

CAS 458541-39-4 is the registry number for 2-((1,1'-Biphenyl)-3-yl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(3-phenylphenyl)pyridine (CAS 458541-39-4) is a chemical compound with the molecular formula C17H13N and a molecular weight of 231.29 g/mol. IUPAC name: 2-(3-phenylphenyl)pyridine. InChIKey: QWVOHJGKYCTVIR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13N
Molecular weight231.29 g/mol
IUPAC name2-(3-phenylphenyl)pyridine
InChIKeyQWVOHJGKYCTVIR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC=N3

Computed by PubChem (NCBI)