CAS 160754-06-3 is the registry number for 2-Methoxy-4,5-dimethyl-1,3-dinitrobenzene. Offered by: TRC. Available pack sizes: 100mg.
4-methoxy-1,2-dimethyl-3,5-dinitrobenzene (CAS 160754-06-3) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 4-methoxy-1,2-dimethyl-3,5-dinitrobenzene. InChIKey: LKXZNULPLFYVSF-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 4-methoxy-1,2-dimethyl-3,5-dinitrobenzene |
| InChIKey | LKXZNULPLFYVSF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)[N+](=O)[O-])OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)