CAS 1607590-90-8 is the registry number for 6-Bromo-5-chloro-2-methylimidazo[1,2-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5-chloro-2-methylimidazo[1,2-a]pyrazine (CAS 1607590-90-8) is a chemical compound with the molecular formula C7H5BrClN3 and a molecular weight of 246.49 g/mol. IUPAC name: 6-bromo-5-chloro-2-methylimidazo[1,2-a]pyrazine. InChIKey: UUSCVDMELNQVJG-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3 |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 6-bromo-5-chloro-2-methylimidazo[1,2-a]pyrazine |
| InChIKey | UUSCVDMELNQVJG-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C=NC(=C2Cl)Br |
Computed by PubChem (NCBI)