CAS 160777-16-2 is the registry number for Ethyl 2-benzoyl-3-(dimethylamino)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Ethyl (E)-2-benzoyl-3-(dimethylamino)prop-2-enoate (CAS 160777-16-2) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: ethyl (E)-2-benzoyl-3-(dimethylamino)prop-2-enoate. InChIKey: YBFKACALUIUGHN-ZRDIBKRKSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | ethyl (E)-2-benzoyl-3-(dimethylamino)prop-2-enoate |
| InChIKey | YBFKACALUIUGHN-ZRDIBKRKSA-N |
| SMILES | CCOC(=O)/C(=C/N(C)C)/C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)