Products 66129-60-0
CAS 66129-60-0 appears in our catalog under these names: Ethyl 2-benzoyl-3-(dimethylamino)acrylate, 96%, ethyl-3-(diMethylaMino)-2-(phenylcarbonyl)prop-2-enoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g, 2,5g.
Ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate (CAS 66129-60-0) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate. InChIKey: YBFKACALUIUGHN-BENRWUELSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate |
| InChIKey | YBFKACALUIUGHN-BENRWUELSA-N |
| SMILES | CCOC(=O)/C(=C\N(C)C)/C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)