CAS 16078-35-6 is the registry number for 1,5-Diacetylindoline, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(1-acetyl-2,3-dihydroindol-5-yl)ethanone (CAS 16078-35-6) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 1-(1-acetyl-2,3-dihydroindol-5-yl)ethanone. InChIKey: DDTZNSOMVMYKHA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-(1-acetyl-2,3-dihydroindol-5-yl)ethanone |
| InChIKey | DDTZNSOMVMYKHA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N(CC2)C(=O)C |
Computed by PubChem (NCBI)