CAS 1608495-27-7 appears in our catalog under these names: (3S)-2-(1,1-Dimethylethyl) Ester 2-Azaspiro(4.4)nonane-2,3-dicarboxylic Acid, (S)-2-(tert-Butoxycarbonyl)-2-azaspiro[4.4]nonane-3-carboxylic acid, 97%, 97%, (S)-2-(tert-Butoxycarbonyl)-2-azaspiro[4.4]nonane-3-carboxylic acid, 97%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 500mg, 5g, 10g.
(3S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[4.4]nonane-3-carboxylic acid (CAS 1608495-27-7) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: (3S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[4.4]nonane-3-carboxylic acid. InChIKey: FWOIYCWMKBOPEY-JTQLQIEISA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | (3S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[4.4]nonane-3-carboxylic acid |
| InChIKey | FWOIYCWMKBOPEY-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCCC2)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)