CAS 160878-87-5 appears in our catalog under these names: 2-(4-Methoxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(4-Methoxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 160878-87-5) is a chemical compound with the molecular formula C16H11NO5 and a molecular weight of 297.26 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: LYYLAXSLLVRTCM-UHFFFAOYSA-N.
| Molecular formula | C16H11NO5 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | LYYLAXSLLVRTCM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)