CAS 65162-83-6 is the registry number for Benzyl (1,3-dioxoisoindolin-2-yl) carbonate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (1,3-dioxoisoindol-2-yl) carbonate (CAS 65162-83-6) is a chemical compound with the molecular formula C16H11NO5 and a molecular weight of 297.26 g/mol. IUPAC name: benzyl (1,3-dioxoisoindol-2-yl) carbonate. InChIKey: QHZNYGVZDCMWKX-UHFFFAOYSA-N.
| Molecular formula | C16H11NO5 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | benzyl (1,3-dioxoisoindol-2-yl) carbonate |
| InChIKey | QHZNYGVZDCMWKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)