CAS 92858-63-4 is the registry number for (E)-3-(Benzo[d][1,3]dioxol-5-yl)-1-(4-nitrophenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)prop-2-en-1-one (CAS 92858-63-4) is a chemical compound with the molecular formula C16H11NO5 and a molecular weight of 297.26 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)prop-2-en-1-one. InChIKey: FMNQGVMNCNMWBE-LREOWRDNSA-N.
| Molecular formula | C16H11NO5 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)prop-2-en-1-one |
| InChIKey | FMNQGVMNCNMWBE-LREOWRDNSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)