CAS 1608986-16-8 appears in our catalog under these names: Bortezomib Impurity 65, (R)–3–Phenyl–2–(pyrazine–2–carboxamido)propanoic acid, (R)-3-Phenyl-2-(pyrazine-2-carboxamido)propanoic acid, 95%. Offered by: Chemat Brand, GLPBio, Fluorochem. Available pack sizes: on request, 100mg, 1g.
(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoic acid (CAS 1608986-16-8) is a chemical compound with the molecular formula C14H13N3O3 and a molecular weight of 271.27 g/mol. IUPAC name: (2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoic acid. InChIKey: DWYZPDHMMZGQAP-LLVKDONJSA-N.
| Molecular formula | C14H13N3O3 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | (2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoic acid |
| InChIKey | DWYZPDHMMZGQAP-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)