CAS 1573547-48-4 is the registry number for 3-(2-Methyl-4-oxo-1,4-dihydropyrimido[1,2-b]indazol-3-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)propanoic acid (CAS 1573547-48-4) is a chemical compound with the molecular formula C14H13N3O3 and a molecular weight of 271.27 g/mol. IUPAC name: 3-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)propanoic acid. InChIKey: YXGXYBFHTYVNHS-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O3 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 3-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)propanoic acid |
| InChIKey | YXGXYBFHTYVNHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)C3=CC=CC=C3N2)CCC(=O)O |
Computed by PubChem (NCBI)