CAS 834896-23-0 is the registry number for Methyl 6-(2-furyl)-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate (CAS 834896-23-0) is a chemical compound with the molecular formula C14H13N3O3 and a molecular weight of 271.27 g/mol. IUPAC name: methyl 6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate. InChIKey: PIIUFEGDUBHVBN-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O3 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | methyl 6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate |
| InChIKey | PIIUFEGDUBHVBN-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CC=CO3)C(=O)OC)C |
Computed by PubChem (NCBI)