CAS 1609192-68-8 appears in our catalog under these names: Tolfenamic Acid Impurity, 3-Chloro-4-methyl-9(10H)-acridinone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
3-chloro-4-methyl-10H-acridin-9-one (CAS 1609192-68-8) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 3-chloro-4-methyl-10H-acridin-9-one. InChIKey: CPAFNOCPCHSQAU-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-chloro-4-methyl-10H-acridin-9-one |
| InChIKey | CPAFNOCPCHSQAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)