Products 1609202-75-6 net

CAS 1609202-75-6 net is the registry number for Boc-D-Aha-OH*CHA. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.

Structural formula: {0} (CAS {1})

(2R)-4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1609202-75-6) is a chemical compound with the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. IUPAC name: (2R)-4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: IHUIGGNXSPZEEI-ZCFIWIBFSA-N.

Identity
Molecular formulaC9H16N4O4
Molecular weight244.25 g/mol
IUPAC name(2R)-4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyIHUIGGNXSPZEEI-ZCFIWIBFSA-N
SMILESCC(C)(C)OC(=O)N[C@H](CCN=[N+]=[N-])C(=O)O

Computed by PubChem (NCBI)