Products 1923268-76-1

CAS 1923268-76-1 is the registry number for N3-Dbu(Boc)-OH (R). Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(3R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1923268-76-1) is a chemical compound with the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. IUPAC name: (3R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: SXHVRORHDYNPGX-ZCFIWIBFSA-N.

Identity
Molecular formulaC9H16N4O4
Molecular weight244.25 g/mol
IUPAC name(3R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeySXHVRORHDYNPGX-ZCFIWIBFSA-N
SMILESCC(C)(C)OC(=O)NC[C@@H](CC(=O)O)N=[N+]=[N-]

Computed by PubChem (NCBI)