Products 1609259-33-7
CAS 1609259-33-7 is the registry number for 4-chloro-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-pyrazolo[4,3-c]pyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[(4-chloropyrazolo[4,5-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane (CAS 1609259-33-7) is a chemical compound with the molecular formula C12H18ClN3OSi and a molecular weight of 283.83 g/mol. IUPAC name: 2-[(4-chloropyrazolo[4,5-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: VUEATEAJTVJQEG-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3OSi |
|---|---|
| Molecular weight | 283.83 g/mol |
| IUPAC name | 2-[(4-chloropyrazolo[4,5-c]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | VUEATEAJTVJQEG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C2=C(C=N1)C(=NC=C2)Cl |
Computed by PubChem (NCBI)