CAS 1609388-44-4 is the registry number for [(2S,4R)-4-(Dimethylamino)-2-pyrrolidinyl]methanol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
[(2S,4R)-4-(dimethylamino)pyrrolidin-2-yl]methanol;dihydrochloride (CAS 1609388-44-4) is a chemical compound with the molecular formula C7H18Cl2N2O and a molecular weight of 217.13 g/mol. IUPAC name: [(2S,4R)-4-(dimethylamino)pyrrolidin-2-yl]methanol;dihydrochloride. InChIKey: KBUWFDDZDZIZMH-AUCRBCQYSA-N.
| Molecular formula | C7H18Cl2N2O |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | [(2S,4R)-4-(dimethylamino)pyrrolidin-2-yl]methanol;dihydrochloride |
| InChIKey | KBUWFDDZDZIZMH-AUCRBCQYSA-N |
| SMILES | CN(C)[C@@H]1C[C@H](NC1)CO.Cl.Cl |
Computed by PubChem (NCBI)